| Identification | |
| Name: | 1-Chloro-4-nitrobenzene |
| Synonyms: | p-Nitrochlorobenzene; 4-Nitrochlorobenzene; P-Nitro chloro benzene; p-chloronitrobenzene |
| CAS: | 100-00-5 |
| EINECS: | 202-809-6 |
| Molecular Formula: | C6H4ClNO2 |
| Molecular Weight: | 157.56 |
| InChI: | InChI=1/C6H4ClNO2/c7-5-1-3-6(4-2-5)8(9)10/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1578 |
| Density: | 1.298 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, hydroxides. Reacts violently with sodium methoxide in methanol. |
| Refractive index: | 1.5376 (100 C) |
| Water Solubility: | Insoluble |
| Solubility: | Insoluble |
| Appearance: | light yellow crystals |
| Specification: | light yellow crystals Safety Statements:28-36/37-45-61-28A 28:After contact with skin, wash immediately with plenty of ... (to be specified by the manufacturer) 36/37:Wear suitable protective clothing and gloves 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Packinggroup: | II |
| HS Code: | 29049085 |
| Storage Temperature: | Store in a cool, dry place. Store in a cool, dry, well-ventilated area away from incompatible substances. Keep containers tightly closed. |
| Color: | Monoclinic prisms Yellow crystals Yellow, crystalline solid |
| Usage: | P-chloronitrobenzene is used to manufacture p-nitrophenol, p-nitroaniline, p-aminophenol, phenacetin, acetominophen, parathion and other agricultural chemicals, rubber chemicals, antioxidants, oil additives and dapsone (an antimalarial drug). |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
