| Identification | |
| Name: | Quinuclidine |
| Synonyms: | Quinuclidine(6CI,7CI,8CI);1,4-Ethanopiperidine;1,4-Ethylenepiperidine;ABCO;NSC 168431;1-Azabicyclo[2.2.2]octane; |
| CAS: | 100-76-5 |
| EINECS: | 202-887-1 |
| Molecular Formula: | C7H13N |
| Molecular Weight: | 111.18 . |
| InChI: | InChI=1/C7H13N/c1-4-8-5-2-7(1)3-6-8/h7H,1-6H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 281 |
| Melting Point: | 157 - 160 C |
| Flash Point: | STABILITY |
| Density: | 0.97 g/cm3 |
| Refractive index: | 1.512 |
| Appearance: | white to yellowish crystalline powder |
| Specification: | Safety Statements:26-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | III |
| Flash Point: | STABILITY |
| Safety Data | |
 |
|
