| Identification |
| Name: | Benzenemethanamine,3-fluoro- |
| Synonyms: | Benzylamine,m-fluoro- (7CI,8CI);(3-Fluorophenyl)methanamine;1-(3-Fluorophenyl)methanamine;3-Fluorobenzylamine;3-Fluorophenylmethylamine;m-Fluorobenzylamine; |
| CAS: | 100-82-3 |
| EINECS: | 202-891-3 |
| Molecular Formula: | C7H8FN |
| Molecular Weight: | 125.14 |
| InChI: | InChI=1/C7H8FN/c8-7-3-1-2-6(4-7)5-9/h1-4H,5,9H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2735 |
| Density: | 1.097 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5152 |
| Solubility: | Very soluble |
| Appearance: | Clear
liquid |
| Packinggroup: | III |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Corrosives area. |
| Sensitive: | Air Sensitive |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
