| Identification | |
| Name: | 3-Methylanisole |
| Synonyms: | 1-Methoxy-3-methylbenzene; m-Methoxytoluene; m-Cresyl methyl ether; 3-Methoxytoluene; m-Methylanisole |
| CAS: | 100-84-5 |
| EINECS: | 202-893-4 |
| Molecular Formula: | C8H10O |
| Molecular Weight: | 122.17 |
| InChI: | InChI=1/C8H10O/c1-7-4-3-5-8(6-7)9-2/h3-6H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 |
| Melting Point: | -47 |
| Density: | 0.969 |
| Stability: | Stable. Flammable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.512-1.514 |
| Water Solubility: | Insoluble AUTOIGNITION |
| Solubility: | Insoluble AUTOIGNITION |
| Appearance: | clear to slightly yellow liquid |
| Specification: | colourless liquid Safety Statements:16-23-24/25 16:Keep away from sources of ignition - No smoking 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 24/25:Avoid contact with skin and eyes |
| Packinggroup: | III |
| Storage Temperature: | Flammables area |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
