| Identification |
| Name: | Octadecanoic acid,ammonium salt (1:1) |
| Synonyms: | Octadecanoicacid, ammonium salt (9CI); Stearic acid, ammonium salt (8CI); Ammoniumstearate; DC 100A; Kanebinol YC 81; Ligafluid AS 35; Nopco DC 100A; Nopcote DC100A; Stanfax 320; Stokal STA; YC 81 |
| CAS: | 1002-89-7 |
| EINECS: | 213-695-2 |
| Molecular Formula: | C18H36 O2 . H3 N |
| Molecular Weight: | 301.50776 |
| InChI: | InChI=1S/C18H36O2.H3N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;/h2-17H2,1H3,(H,19,20);1H3 |
| Molecular Structure: |
 |
| Properties |
| Stability: | Incompatible with strong oxidizing agents. |
| Water Solubility: | slightly soluble in Water |
| Solubility: | slightly soluble in Water |
| Appearance: | cream or light yellow powder |
| Specification: |
Ammonium stearate (CAS NO.1002-89-7) has weak oxidizing or reducing powers. Redox reactions can however still occur. The majority of compounds in this class are slightly soluble or insoluble in water. If soluble in water, then the solutions are usually neither strongly acidic nor strongly basic. These compounds are not water-reactive.
|
| Report: |
Reported in EPA TSCA Inventory.
|
| Safety Data |
| Hazard Symbols |
A nuisance dust. TLV: TWA 10 
|
| |
 |