| Identification | |
| Name: | Trichlorosilane |
| Synonyms: | trichlorosilane pressure tin; Trichlorosilanecolorlessliq; silicon chloroform; Trichlorosilane,98% |
| CAS: | 10025-78-2 |
| EINECS: | 233-042-5 |
| Molecular Formula: | Cl3HSi |
| Molecular Weight: | 135.45 |
| InChI: | InChI=1/Cl3HSi/c1-4(2)3/h4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1295 4.3/PG 1 |
| Density: | 1.34 |
| Stability: | Stable, but extremely flammable. Pyrophoric - spontaneously ignites in air. Explosion hazard in air - note wide explosion limits. Reacts violently with water. Incompatible with moisture, acids, bases, strong oxidizing agents, alcohols, amines. |
| Refractive index: | 1.4-1.402 |
| Water Solubility: | decomposes |
| Solubility: | decomposes |
| Appearance: | liquid |
| Specification: |
Removal in wastewater treatment of Trichlorosilane (10025-78-2) can be stated as follows: |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | I |
| Storage Temperature: | Refrigerator |
| Sensitive: | Air & Moisture Sensitive |
| Color: | Colorless liquid |
| Usage: | In manufacture of transistors. |
| Safety Data | |
| Hazard Symbols |
F+:Highlyflammable
C:Corrosive
|
 |
|
