| Identification | |
| Name: | 2-Propenoic acid,2-(hydroxymethyl)-, ethyl ester |
| Synonyms: | Acrylicacid, 2-(hydroxymethyl)-, ethyl ester (8CI); Hydracrylic acid, 2-methylene-,ethyl ester (7CI); Ethyl 2-(hydroxymethyl)acrylate; Ethyl2-hydroxymethyl-2-propenoate; Ethyl a-(hydroxymethyl)acrylate; Ethyl a-hydroxymethacrylate; RHMA-E |
| CAS: | 10029-04-6 |
| Molecular Formula: | C6H10O3 |
| Molecular Weight: | 130.14 |
| InChI: | InChI=1/C6H10O3/c1-3-9-6(8)5(2)4-7/h7H,2-4H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 78.9°C |
| Boiling Point: | 198.6°Cat760mmHg |
| Density: | 1.054g/cm3 |
| Refractive index: | 1.481 |
| Solubility: | 1.643e+005(mg/L) at 25 °C |
| Appearance: | colourless oil |
| Specification: |
Ethyl 2-(hydroxymethyl)prop-2-enoate with CAS number of 10029-04-6 is also called for Ethyl 2-(hydroxymethyl)acrylate ; 2-(Hydroxymethyl)acrylic acid ethyl ester ; 2-(Hydroxymethyl)-2-propenoicaciethylester ; 2-(Hydroxymethyl)-acrylicaciethylester ; Ethyl2-(hydroxymethyl)-2-propenoate ; Ethylalpha-(hydroxymethyl)acrylate ; licacidethylester ; 2-(Hydroxymethyl)acrylic acid ethyl ester 95% . |
| Flash Point: | 78.9°C |
| Storage Temperature: | Refrigerator |
| Usage: |
Ethyl 2-(hydroxymethyl)prop-2-enoate (CAS NO.10029-04-6) can be used for the synthesis of aza inhibitors and some potential antitumor agents. |
| Safety Data | |
 |
|
