| Identification |
| Name: | Pyridine, 3-methyl-,1-oxide |
| Synonyms: | 3-Picoline,1-oxide (6CI,8CI);3-Methylpyridine 1-oxide;3-Methylpyridine N-oxide;3-Picoline N-oxide;NSC 18254;b-Picoline 1-oxide;b-Picoline N-oxide;b-Picoline oxide;N-oxide of 3-methyl pyridine; |
| CAS: | 1003-73-2 |
| EINECS: | 213-714-4 |
| Molecular Formula: | C6H7NO |
| Molecular Weight: | 109.13 |
| InChI: | InChI=1/C6H7NO/c1-6-3-2-4-7(8)5-6/h2-5H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.01g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5839 (45 C) |
| Water Solubility: | soluble |
| Solubility: | soluble |
| Appearance: | Brown solid. |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Hygroscopic |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
