| Identification |
| Name: | Benzaldehyde, 4-ethoxy- |
| Synonyms: | Benzaldehyde,p-ethoxy- (6CI,8CI);Ethoxybenzaldehyde;NSC 406709;p-Ethoxybenzaldehyde; |
| CAS: | 10031-82-0 |
| EINECS: | 233-093-3 |
| Molecular Formula: | C9H10O2 |
| Molecular Weight: | 150.17 |
| InChI: | InChI=1/C9H10O2/c1-2-11-9-5-3-8(7-10)4-6-9/h3-7H,2H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.08 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5574-1.5594 |
| Solubility: | Insoluble |
| Appearance: | yellow to light brown clear liquid |
| Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Air Sensitive |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
