| Identification | |
| Name: | Orthoboric acid |
| Synonyms: | Boric Acid, MB Grade (1.12015); Boron; Boricacidhighpurity; Boricacidwhitextl; Boric acid - specially pure; Boric Acid BP |
| CAS: | 10043-35-3 |
| EINECS: | 233-139-2 |
| Molecular Formula: | H3BO3 |
| Molecular Weight: | 61.83 |
| InChI: | InChI=1/BH3O3/c2-1(3)4/h2-4H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.435 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.462 |
| Appearance: | colourless or white odourless crystalline solid |
| Specification: |
?Orthoboric acid , its cas register number is 10043-35-3. It also can be called?Boric acid ; Basilit B ; Boracic acid ; Boric acid (BH3O3)? ; Borofax ; Boron hydroxide ; Borsaeure ; Dr.'s 1 Flea Terminator DF ; Orthoboric acid ; Orthoborsaeure ; Super Flea Eliminator ; Three elephant ; Trihydroxyborone .It is a?colorless, odorless scales or white powder. |
| Packinggroup: | Z01 |
| HS Code: | 28100090 |
| Storage Temperature: | Store at RT. |
| Sensitive: | Hygroscopic |
| Usage: | Weatherproofing wood, nickling baths, for printing & dyeing, & for impregnating wicks, manufacture cements, crockery, porcelain, enamels, glass, borates, leather, carpets, hats, soaps, artificial gems, in painting, photography, electric condensers, hardening steel. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
