| Identification |
| Name: | 2H-Benzimidazol-2-one,1-ethyl-1,3-dihydro- |
| Synonyms: | 2-Benzimidazolinone,1-ethyl- (6CI,7CI,8CI); 1-Ethyl-1,3-dihydrobenzimidazol-2-one;1-Ethyl-2-oxo-2,3-dihydrobenzimidazole; 1-Ethylbenzimidazolin-2-one;1-Ethylbenzimidazolinone; 3-Ethyl-2-benzimidazolinone |
| CAS: | 10045-45-1 |
| EINECS: | 233-148-1 |
| Molecular Formula: | C9H10 N2 O |
| Molecular Weight: | 162.19 |
| InChI: | InChI=1/C9H10N2O/c1-2-11-8-6-4-3-5-7(8)10-9(11)12/h3-6H,2H2,1H3,(H,10,12) |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.161g/cm3 |
| Refractive index: | 1.566 |
| Biological Activity: | Activator of epithelial K Ca channels, stimulates a large and sustained trans-epithelial Cl - secretory response across T84 monolayers. Induces hyperpolarization to the same magnitude as ACh in aortic value endothelial cells. |
| Safety Data |
| |
 |
