| Identification |
| Name: | 5-Bromoindole |
| Synonyms: | 1H-Indole, 5-bromo- (9CI);5-bromo-1H-indole;1H-Indole, 5-bromo-;5-Bromo Indole; |
| CAS: | 10075-50-0 |
| EINECS: | 233-208-7 |
| Molecular Formula: | C8H6BrN |
| Molecular Weight: | 196.05 |
| InChI: | InChI=1/C8H6BrN/c9-7-1-2-8-6(5-7)3-4-10-8/h1-5,10H |
| Molecular Structure: |
 |
| Properties |
| Transport: | 25kgs |
| Flash Point: | 110 C |
| Density: | 1.66g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.711 |
| Appearance: | white to beige crystalline powder |
| HS Code: | 29339990 |
| Flash Point: | 110 C |
| Safety Data |
| |
 |
