| Identification |
| Name: | Anthracene,9,10-bis(2-phenylethynyl)- |
| Synonyms: | Anthracene,9,10-bis(phenylethynyl)- (6CI,7CI,8CI,9CI);9,10-Bis(phenethynyl)anthracene;9,10-Bis(phenylethynyl)anthracene;9,10-Bis(phenylvinyl)anthracene;BPEA;BPEA(scintillator additive);Cyalume Green; |
| CAS: | 10075-85-1 |
| EINECS: | 233-210-8 |
| Molecular Formula: | C30H18 |
| Molecular Weight: | 378.47 |
| InChI: | InChI=1/C30H18/c1-3-11-23(12-4-1)19-21-29-25-15-7-9-17-27(25)30(28-18-10-8-16-26(28)29)22-20-24-13-5-2-6-14-24/h1-18H |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.23 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.753 |
| Appearance: | orange crystal solid, no impurity |
| Specification: |
9,10-Bis(phenylethynyl)anthracene , its cas register number is 10075-85-1. It also can be called EINECS 233-210-8 ; Anthracene, 9,10-bis(2-phenylethynyl)- ; Anthracene, 9,10-bis(phenylethynyl)- .It is a orange crystalline powder.
|
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Light Sensitive |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |