| Identification | |
| Name: | Propanoic acid,2-(3-chlorophenoxy)- |
| Synonyms: | Propionicacid, 2-(m-chlorophenoxy)- (6CI,7CI,8CI);(RS)-2-(3-Chlorophenoxy)propionicacid;2-(3-Chlorophenoxy)propanoic acid;2-(3-Chlorophenoxy)propionic acid;2-(m-Chlorophenoxy)propionic acid;3-CPPA;3CP;Cloprop;Fruitone CPA;Metachlorphenprop;Swelpine;a-(3-Chlorophenoxy)propionic acid; |
| CAS: | 101-10-0 |
| EINECS: | 202-915-2 |
| Molecular Formula: | C9H9ClO3 |
| Molecular Weight: | 200.62 |
| InChI: | InChI=1/C9H9ClO3/c1-6(9(11)12)13-8-4-2-3-7(10)5-8/h2-6H,1H3,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.307 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Solubility: | Very soluble |
| Specification: | white to off-white crystalline powder Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Storage Temperature: | 0-6°C |
| Color: | Colorless crystals |
| Usage: | Herbicide. Fruit thinner, plums, prunes. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
