| Identification | |
| Name: | Benzenamine,3-chloro-N-phenyl- |
| Synonyms: | Diphenylamine,3-chloro- (6CI,8CI);N-(3-Chlorophenyl)aniline;N-(m-Chlorophenyl)aniline;Phenyl(m-chlorophenyl)amine;m-Chlorodiphenylamine; |
| CAS: | 101-17-7 |
| EINECS: | 202-922-0 |
| Molecular Formula: | C12H10ClN |
| Molecular Weight: | 203.67 |
| InChI: | InChI=1/C12H10ClN/c13-10-5-4-8-12(9-10)14-11-6-2-1-3-7-11/h1-9,14H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1,21 g/cm3 |
| Refractive index: | 1.642 |
| Specification: | Safety Statements:28-36/37 28:After contact with skin, wash immediately with plenty of ... (to be specified by the manufacturer) 36/37:Wear suitable protective clothing and gloves |
| Safety Data | |
 |
|
