| Identification | ||
| Name: | 2-Propenal,2-methyl-3-phenyl- | |
| Synonyms: | Cinnamaldehyde,a-methyl- (6CI,7CI,8CI);2-Methyl-3-phenyl-2-propen-1-al;2-Methyl-3-phenyl-2-propenal;2-Methyl-3-phenylacrolein;2-Methyl-3-phenylacrylaldehyde;2-Methyl-3-phenylpropenal;2-Methylcinnamic aldehyde;Methylcinnamaldehyde;NSC22283;NSC 49286;a-Methylcinnamic aldehyde; | |
| CAS: | 101-39-3 | |
| EINECS: | 202-938-8 | |
| Molecular Formula: | C10H10O | |
| Molecular Weight: | 146.19 | |
| InChI: | InChI=1/C10H10O/c1-9(8-11)7-10-5-3-2-4-6-10/h2-8H,1H3/b9-7- | |
| Molecular Structure: |  |
|
| Properties | ||
| Melting Point: | -22 | |
| Density: | 1.047 | |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, strong bases. | |
| Refractive index: | 1.605-1.607 | |
| Water Solubility: | <0.1 g/100 mL at 21 ºC | |
| Solubility: | <0.1 g/100 mL at 21 oC | |
| Appearance: | yellow liquid | |
| Specification: | yellow liquid Safety Statements:24/25 24/25:Avoid contact with skin and eyes | |
| Packinggroup: | I; II; III | |
| HS Code: | 29122900 | |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. | |
| Sensitive: | Air Sensitive | |
| Safety Data | ||
| Hazard Symbols |
Xi:Irritant
|
|
 |
||
