| Identification | |
| Name: | Urea,N,N-dimethyl-N'-phenyl- |
| Synonyms: | Urea,1,1-dimethyl-3-phenyl- (8CI); 1,1-Dimethyl-3-phenylurea;1-Phenyl-3,3-dimethylurea; 3-Phenyl-1,1-dimethylurea; Amicure UR; Dibar; Dybar;Dyhard RU 300; Dyhard UR 300; Falisilvan; Fenuron; Fikure 62U;N,N-Dimethyl-N'-phenylurea; N-Phenyl-N',N'-dimethylurea; Omicure 94; Omicure U405; PUD |
| CAS: | 101-42-8 |
| EINECS: | 202-941-4 |
| Molecular Formula: | C9H12 N2 O |
| Molecular Weight: | 164.23 |
| InChI: | InChI=1S/C9H12N2O/c1-11(2)9(12)10-8-6-4-3-5-7-8/h3-7H,1-2H3,(H,10,12) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1648 3/PG 2 |
| Flash Point: | 153.3°C |
| Boiling Point: | 329.8°Cat760mmHg |
| Density: | 1.122g/cm3 |
| Solubility: | 3850 ppm @ 25 deg C Sparingly sol in water (0.29% at 24 deg C) Solubility (25 deg C): 3.85 g/l water; sparingly soluble in hydrocarbons. In ethanol 108.8, diethylether 5.5, acetone 80.2, benzene 3.1, chloroform 125, n-hexane 0.2, groundnut oil 1.0 (all in g/kg at 20-25 deg C) In water 3.85 g/l at 25 deg C |
| Specification: | Safety Statements:24-26-36-16 24:Avoid contact with skin 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 16:Keep away from sources of ignition - No smoking |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 153.3°C |
| Storage Temperature: | APPROX 4°C |
| Color: | White, crystalline solid Colorless crystalline solid Colorless crystals |
| Safety Data | |
| Hazard Symbols | |
 |
|
