| Identification | |
| Name: | 2-Propenoic acid,2-methyl-, cyclohexyl ester |
| Synonyms: | Methacrylicacid, cyclohexyl ester (6CI,7CI,8CI);Cyclohexanol, methacrylate (6CI);Acryester CH;Blemmer CHMA;Light Ester CH;MhoromerBM 711;NSC 20968;SR 208; |
| CAS: | 101-43-9 |
| EINECS: | 202-943-5 |
| Molecular Formula: | C10H16O2 |
| Molecular Weight: | 168.23 |
| InChI: | InChI=1/C10H16O2/c1-8(2)10(11)12-9-6-4-3-5-7-9/h9H,1,3-7H2,2H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 107 |
| Density: | 0.96 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.457-1.459 |
| Water Solubility: | negligible |
| Solubility: | negligible |
| Appearance: | Beige powder. |
| Specification: | clear colorless to slightly yellow liquid Safety Statements:26-28-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 28:After contact with skin, wash immediately with plenty of ... (to be specified by the manufacturer) 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Storage Temperature: | 2-8°C |
| Color: | COLORLESS LIQUID |
| Usage: | Optical lens systems, dental resins, encapsulation of electronic assemblies. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
