| Identification | |
| Name: | Methylene diphenyl diisocyanate |
| Synonyms: | 1,1-methylenebis(4-isocyanatobenzene); 4,4'-diisocyanatodiphenylmethane; Methylenebis(phenylisocyanate); nocconate 300; PMDI; 4,4'-diphenyl methane diisocyanate; 4,4'-Methylene bisphenyl isocyanate; 4,4'-methylenedi(4,1-phenylene) isocyanate; 4,4'-Methylenediphenyl diisocyanate; bis(p-isocyanatophenyl)methane; Diphenylmethane-4,4'-diisocyanate; Diphenyl methane diisocyanate; Diphenylmethyl Diisocyanate; caradate 30; desmodur 44; hylene m50; isonate 125m; isonate 125mf; MBI; Methylene diphenyl diisocyanate (monomeric and pol? METHYLENE BISPHENYL ISOCYANATE; methylenebis(4-isocyanatobenzene); Methylenedi-p-phenyl diisocyanate; Methylenedi-p-phenyl diisocyanate, stabilized flakes, contains 1.5% 2,4[-isomer; methylenedi-p-phenylene diisocyanate; methylenebis(p-phenylene isocyanate); methylenebis(p-phenyl isocyanate); Methylenediphenyl Diisocyanate; MDI |
| CAS: | 101-68-8 |
| EINECS: | 202-966-0 |
| Molecular Formula: | C15H10N2O2 |
| Molecular Weight: | 250.25 |
| InChI: | InChI=1/C15H10N2O2/c18-10-16-14-5-1-12(2-6-14)9-13-3-7-15(8-4-13)17-11-19/h1-8H,9H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Density: | 1.19 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. Reacts violently with alcohols. |
| Refractive index: | 1.5906 (50 C) |
| Water Solubility: | decomposes |
| Solubility: | decomposes |
| Appearance: | white to light yellow flakes or crystals |
| Packinggroup: | II |
| HS Code: | 29291090 |
| Storage Temperature: | Refrigerator |
| Sensitive: | Moisture Sensitive/Lachrymatory |
| Color: | Light-yellow, fused solid Crystals White to light yellow flakes [Note: A liquid above 99 degrees F]. |
| Usage: | Adhesives, coatings manufacture, elastomers, flexible foam, rigid foam. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
