| Identification | |
| Name: | 1H-Isoindole-1,3(2H)-dione,2-(1-methylpropyl)- |
| Synonyms: | Phthalimide,N-sec-butyl- (6CI,8CI); 2-(1-Methylpropyl)-1H-isoindole-1,3(2H)-dione;N-sec-Butylphthalimide; NSC 5681 |
| CAS: | 10108-61-9 |
| EINECS: | 233-295-1 |
| Molecular Formula: | C12H13 N O2 |
| Molecular Weight: | 203.26 |
| InChI: | InChI=1/C12H13NO2/c1-3-8(2)13-11(14)9-6-4-5-7-10(9)12(13)15/h4-8H,3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 126°C |
| Boiling Point: | 302.8°Cat760mmHg |
| Density: | 1.187g/cm3 |
| Refractive index: | 1.569 |
| Specification: |
N-sec-Butylphthalimide (CAS NO.10108-61-9) also can be called N-sek.Butylftalimid ; 1H-Isoindole-1,3(2H)-dione, 2-(1-methylpropyl)- ; and Phthalimide, N-sec-butyl- . |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 126°C |
| Safety Data | |
 |
|
