| Identification |
| Name: | Benzenemethanol, a-(aminomethyl)-4-hydroxy-3-methoxy-,hydrochloride (1:1) |
| CAS: | 1011-74-1 |
| EINECS: | 213-787-2 |
| Molecular Formula: | C9H13 N O3 . Cl H |
| Molecular Weight: | 219.67 |
| InChI: | InChI=1/C9H13NO3.ClH/c1-13-9-4-6(8(12)5-10)2-3-7(9)11;/h2-4,8,11-12H,5,10H2,1H3;1H/t8-;/m0./s1 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 204 °C (dec.)(lit.)
|
| Flash Point: | 192°C |
| Boiling Point: | 393.8°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 192°C |
| Usage: | A metabolite of Epinephrine. A naturraly occurring derivative of Epinephrine, found together with Metanephrine in urine and in certain tissues. |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
