| Identification | |
| Name: | Benzophenone imine |
| Synonyms: | Diphenylmethane imine;Diphenylmethanimine;Iminodiphenylmethane;a-Phenylbenzenemethanimine;Benzenemethanimine, a-phenyl-;Methylenimine,1,1-diphenyl- (6CI,7CI,8CI);1,1-Diphenylmethaneimine;1,1-Diphenylmethanimine;1,1-Diphenylmethylenimine;Benzhydrylidenimine;Benzhydrylimine;Benzophenoneimine;Benzophenonimine;Diphenylketimine; |
| CAS: | 1013-88-3 |
| Molecular Formula: | C13H11N |
| Molecular Weight: | 181.23 |
| InChI: | InChI=1/C13H11N/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,14H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.08 |
| Refractive index: | 1.617-1.619 |
| Appearance: | colorless or light yellow liquid |
| Specification: |
Benzophenone imine , its cas register number is 1013-88-3. It also can be called 1,1-Diphenylmethylenimine ; Benzhydrylidenimine ; Di(phenyl)methanimine ; Diphenylmethane imine ; Diphenylmethanimine .It is a clear colorless to light yellow-brownish liquid. |
| Storage Temperature: | Keep tightly closed. Store in a cool dry place. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
