| Identification | |
| Name: | Phenylaceticacidisoamylester |
| Synonyms: | Phenylacetic acid isoamyl ester |
| CAS: | 102-19-2 |
| EINECS: | 203-012-6 |
| Molecular Formula: | C13H18O2 |
| Molecular Weight: | 206.28 |
| InChI: | InChI=1/C13H18O2/c1-11(2)8-9-15-13(14)10-12-6-4-3-5-7-12/h3-7,11H,8-10H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.988 g/cm3 |
| Refractive index: | n20/D 1.485(lit.) |
| Solubility: | Insoluble in water, soluble in oil and alcohol |
| Appearance: | Colorless oily liquid |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
