| Identification | |
| Name: | Acetamide,N-(3-aminophenyl)- |
| Synonyms: | m-Aminoacetanilide;Acetanilide,3'-amino- (6CI,7CI,8CI);1-Acetylamino-3-aminobenzene;1-Amino-3-(acetylamino)benzene;3-(Acetylamino)aniline;3-Acetamidoaniline;3-Acetylaminobenzeneamine;3-Amino-N-acetylaniline;N-(3-Aminophenyl)acetamide;N-Acetyl-1,3-diaminobenzene;N-Acetyl-m-phenylenediamine;NSC 165576;m-(Acetylamino)aniline;m-Acetamidoaniline; |
| CAS: | 102-28-3 |
| EINECS: | 203-021-5 |
| Molecular Formula: | C8H10N2O |
| Molecular Weight: | 150.18 |
| InChI: | InChI=1/C8H10N2O/c1-6(11)10-8-4-2-3-7(9)5-8/h2-5H,9H2,1H3,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 189°C |
| Boiling Point: | 388.9°Cat760mmHg |
| Density: | 1.203g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.636 |
| Solubility: | 1-5 g/100 mL at 24 oC |
| Appearance: | Gray solid. |
| Specification: | light brown crystalline powder Safety Statements:26-36-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | III |
| Flash Point: | 189°C |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
