| Identification | |
| Name: | 3,4-Dichlorobenzylamine |
| Synonyms: | - |
| CAS: | 102-49-8 |
| EINECS: | 203-035-1 |
| Molecular Formula: | C7H7Cl2N |
| Molecular Weight: | 176.04 |
| InChI: | InChI=1/C7H7Cl2N/c8-6-2-1-5(4-10)3-7(6)9/h1-3H,4,10H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2735 |
| Melting Point: | 32 |
| Density: | 1.32 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.5775-1.5795 |
| Solubility: | Soluble |
| Appearance: | Colorless to yellow clear liquid |
| Specification: | clear colorless to light yellow liquid Safety Statements:23-26-36/37/39-45 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | III |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
