| Identification | |
| Name: | N,N,N',N'-Tetraethylmethylenediamine |
| Synonyms: | - |
| CAS: | 102-53-4 |
| EINECS: | 203-038-8 |
| Molecular Formula: | C9H22N2 |
| Molecular Weight: | 158.28 |
| InChI: | InChI=1/C9H22N2/c1-5-10(6-2)9-11(7-3)8-4/h5-9H2,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2734 8/PG 2 |
| Flash Point: | 42.3°C |
| Boiling Point: | 169.2°Cat760mmHg |
| Density: | 0.826g/cm3 |
| Refractive index: | n20/D 1.426(lit.) |
| Specification: | Safety Statements:16-26-27-36/37/39-45 16:Keep away from sources of ignition - No smoking 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 27:Take off immediately all contaminated clothing 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | III |
| Flash Point: | 42.3°C |
| Safety Data | |
| Hazard Symbols |
C: Corrosive
|
 |
|
