| Identification | |
| Name: | Propanenitrile,3-[(2-ethylhexyl)oxy]- |
| Synonyms: | Propionitrile,3-[(2-ethylhexyl)oxy]- (6CI,8CI); 2-Cyanoethyl 2-ethylhexyl ether;3-(2-Ethylhexyloxy)propionitrile; b-(2-Ethylhexyloxy)propionitrile |
| CAS: | 10213-75-9 |
| EINECS: | 233-519-8 |
| Molecular Formula: | C11H21 N O |
| Molecular Weight: | 183.33 |
| InChI: | InChI=1/C11H21NO/c1-3-5-7-11(4-2)10-13-9-6-8-12/h11H,3-7,9-10H2,1-2H3 |
| Molecular Structure: | ![(C11H21NO) Propionitrile,3-[(2-ethylhexyl)oxy]- (6CI,8CI); 2-Cyanoethyl 2-ethylhexyl ether;3-(2-Ethylhexyloxy)p...](https://img1.guidechem.com/chem/e/dict/189/10213-75-9.jpg) |
| Properties | |
| Flash Point: | 118.5°C |
| Boiling Point: | 282.1°Cat760mmHg |
| Density: | 0.871g/cm3 |
| Refractive index: | 1.432 |
| Specification: |
Reactivity Profile : Nitriles, such as 3-[(2-Ethylhexyl)oxy]propiononitrile, may polymerize in the presence of metals and some metal compounds. They are incompatible with acids; mixing nitriles with strong oxidizing acids can lead to extremely violent reactions. Nitriles are generally incompatible with other oxidizing agents such as peroxides and epoxides. The combination of bases and nitriles can produce hydrogen cyanide. Nitriles are hydrolyzed in both aqueous acid and base to give carboxylic acids (or salts of carboxylic acids). These reactions generate heat. Peroxides convert nitriles to amides. Nitriles can react vigorously with reducing agents. Acetonitrile and propionitrile are soluble in water, but nitriles higher than propionitrile have low aqueous solubility. They are also insoluble in aqueous acids. |
| Report: |
Cyanide and its compounds are on the Community Right-To-Know List. Reported in EPA TSCA Inventory. |
| Flash Point: | 118.5°C |
| Safety Data | |
 |
|
