| Identification | |
| Name: | 2-Pyrimidinamine,4-[2-(diethylamino)ethoxy]- |
| Synonyms: | 4-(2-diethylaminoethoxy)pyrimidin-2-amine |
| CAS: | 102207-75-0 |
| Molecular Formula: | C10H18 N4 O |
| Molecular Weight: | 210.32 |
| InChI: | InChI=1/C10H18N4O/c1-3-14(4-2)7-8-15-9-5-6-12-10(11)13-9/h5-6H,3-4,7-8H2,1-2H3,(H2,11,12,13) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 182.2°C |
| Boiling Point: | 377.7°Cat760mmHg |
| Density: | 1.095g/cm3 |
| Refractive index: | 1.54 |
| Specification: |
2-Amino-4-diethylaminoethoxypyrimidine ,its cas register number is 102207-75-0. It also can be called Pyrimidine, 2-amino-4-(2-diethylaminoethoxy)- ; and 2-Amino-4-(2-diethylaminoethoxy)pyrimidine . |
| Flash Point: | 182.2°C |
| Safety Data | |
 |
|
