| Identification |
| Name: | Acetamide,N-(2-chloro-6-methylphenyl)-2-[[2-(diethylamino)ethyl]propylamino]-,hydrochloride (1:1) |
| Synonyms: | Acetamide,N-(2-chloro-6-methylphenyl)-2-[[2-(diethylamino)ethyl]propylamino]-,monohydrochloride (9CI) |
| CAS: | 102489-55-4 |
| Molecular Formula: | C18H30 Cl N3 O . Cl H |
| Molecular Weight: | 376.42 |
| InChI: | InChI=1/C18H30ClN3O.ClH/c1-5-11-22(13-12-21(6-2)7-3)14-17(23)20-18-15(4)9-8-10-16(18)19;/h8-10H,5-7,11-14H2,1-4H3,(H,20,23);1H |
| Molecular Structure: |
![(C18H30ClN3O.ClH) Acetamide,N-(2-chloro-6-methylphenyl)-2-[[2-(diethylamino)ethyl]propylamino]-,monohydrochloride (9CI...](https://img1.guidechem.com/chem/e/dict/41/102489-55-4.jpg) |
| Properties |
| Flash Point: | 225.5°C |
| Boiling Point: | 449.3°Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
6'-Chloro-2-((2-(diethylamino)ethyl)propylamino)-o-acetotoluidide hydrochloride , its cas register number is 102489-55-4. It also can be called o-Acetotoluidide, 6'-chloro-2-((2-(diethylamino)ethyl)propylamino)-, hydrochloride . Its classification code are Drug / Therapeutic Agent and Skin / Eye Irritant.
|
| Flash Point: | 225.5°C |
| Safety Data |
| |
 |