| Identification | |
| Name: | Levetiracetam |
| Synonyms: | 2-(2-oxopyrrolidin-1-yl)butanamide;Keppra (TN);1-Pyrrolidineacetamide,R-ethyl-2-oxo-,(RS)-;Levetiracetamum [INN-Latin];(S)-alpha-Ethyl-2-oxo-1-pyrrolidineacetamide;(2R)-2-(2-oxopyrrolidin-1-yl)butanamide;(2S)-2-(2-oxopyrrolidin-1-yl)butanamide;UCB-L 059;Levetiracetam [INN];Keppra;1-Pyrrolidineacetamide, alpha-ethyl-2-oxo-, (S)-;Levetiracetam butanamide; |
| CAS: | 102767-28-2 |
| Molecular Formula: | C8H14N2O2 |
| Molecular Weight: | 170.20896 [g/mol] |
| InChI: | InChI=1S/C8H14N2O2/c1-2-6(8(9)12)10-5-3-4-7(10)11/h6H,2-5H2,1H3,(H2,9,12) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.168 g/cm3 |
| Alpha: | -89.7 o |
| Solubility: | 193 |
| Appearance: | White crystalline powder |
| Specification: |
?Levetiracetam , its cas register number is 102767-28-2. It also can be called?Levetiracetam [INN] ; (-)-(S)-alpha-Ethyl-2-oxo-1-pyrrolidineacetamide ; (S)-alpha-Ethyl-2-oxo-1-pyrrolidineacetamide ; 1-Pyrrolidineacetamide, alpha-ethyl-2-oxo-, (alphaS)- ;?Keppra ; Keppra XR .It is a?white crystalline solid. |
| Biological Activity: | Antiepileptic that displays distinctive properties from conventional antiepileptic drugs. Displays potent seizure protection in animal models of chronic epilepsy but lacks activity in acute seizure models. Binds synaptic vesicle protein 2A (SV2A) and inhibits Na + -dependent Cl - /HCO 3 - exchange. |
| Storage Temperature: | Store in original container in a cool dark place. |
| Usage: | Used as an anticonvulsant |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
