| Identification | ||
| Name: | 2-Ethylhexyl acrylate | |
| Synonyms: | 1-Hexanol, 2-ethyl-, acrylate; 2-ethylhexyl 2-propenoate; 2-Ethylhexyl acrylate, stabilized with 10-20 ppm MEHQ; 2-Ethylhexyl propenoate; 2-Propenoic acid 2-ethylhexyl ester; 2-Propenoic acid octyl ester; acrylic acid 2-ethylhexyl ester; EHA; Octyl Acrylate; | |
| CAS: | 103-11-7 | |
| EINECS: | 203-080-7 | |
| Molecular Formula: | C11H20O2 | |
| Molecular Weight: | 184.28 | |
| InChI: | InChI=1/C11H20O2/c1-4-7-8-10(5-2)9-13-11(12)6-3/h6,10H,3-5,7-9H2,1-2H3 | |
| Molecular Structure: |  |
|
| Properties | ||
| Density: | 0.885 | |
| Stability: | Stability Stable, but polymerizes readily, so is usually inhibited with hydroquinone or its monomethyl ether. Susceptible to hydrolysis. Combustible. Incompatible with oxidizing agents. | |
| Refractive index: | 1.434-1.436 | |
| Water Solubility: | <0.1 g/100 mL at 22 ºC | |
| Solubility: | <0.1 g/100 mL at 22 oC in water | |
| Appearance: | COLOURLESS LIQUID | |
| Specification: | light yellow liquid Safety Statements:36/37-46 36/37:Wear suitable protective clothing and gloves 46:If swallowed, seek medical advice immediately and show this container or label | |
| HS Code: | 29161290 | |
| Color: | Colorless liquid | |
| Usage: | Comonomer with vinyl acetate for polymer emulsion paints, with vinyl chloride for latex paints. | |
| Safety Data | ||
| Hazard Symbols |
Xi:Irritant
|
|
 |
||
