| Identification | |
| Name: | Phenol,4-[(phenylmethyl)amino]- |
| Synonyms: | Phenol,p-(benzylamino)- (6CI,7CI,8CI); 4-(Benzylamino)phenol; 4-N-Benzylaminophenol;4-[(Phenylmethyl)amino]phenol; N-(4-Hydroxyphenyl)benzylamine;N-Benzyl-4-aminophenol; N-Benzyl-4-hydroxyaniline; N-Benzyl-p-aminophenol;p-(Benzylamino)phenol; p-(N-benzylamino)phenol |
| CAS: | 103-14-0 |
| EINECS: | 203-082-8 |
| Molecular Formula: | C13H13 N O |
| Molecular Weight: | 199.25 |
| InChI: | InChI=1/C13H13NO/c15-13-8-6-12(7-9-13)14-10-11-4-2-1-3-5-11/h1-9,14-15H,10H2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 83 ºC |
| Flash Point: | 159.1 ºC |
| Boiling Point: | 195 ºC / 5mmHg |
| Density: | 1.185 g/cm3 |
| Refractive index: | 1.662 |
| Appearance: | off-white solid |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 159.1 ºC |
| Safety Data | |
 |
|
