| Identification | |
| Name: | Butanoicacid, phenylmethyl ester |
| Synonyms: | Butyricacid, benzyl ester (6CI,7CI,8CI); Benzyl butanoate; Benzyl butyrate; Benzyln-butyrate; NSC 8073; Phenylmethyl butanoate; Phenylmethyl butyrate |
| CAS: | 103-37-7 |
| EINECS: | 203-105-1 |
| Molecular Formula: | C11H14O2 |
| Molecular Weight: | 178.23 |
| InChI: | InChI=1/C11H14O2/c1-2-6-11(12)13-9-10-7-4-3-5-8-10/h3-5,7-8H,2,6,9H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.491-1.493 |
| Solubility: | Insoluble |
| Appearance: | Clear, colorless liquid. Floral-like odor. |
| Specification: |
?BENZYL n-BUTYRATE (103-37-7) has some other names such as?N-BUTYRIC ACID BENZYL ESTER ; BUTYRIC ACID BENZYL ESTER ; BENZYL N-BUTANOATE ; BENZYL N-BUTYRATE ; BENZYL BUTANOATE ; BENZYL BUTYRATE ; FEMA 2140 ; Benzylester kyseliny maselne , etc.?BENZYL n-BUTYRATE (103-37-7) is a certified natural product which can be used as pharmaceutical intermediate, flavor and fragrance, etc.?Make sure it is stored in a cool, dry place and stored in a tightly closed container. |
| Report: |
Reported in EPA TSCA Inventory. |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
 |
|
