| Identification | |
| Name: | Phenethyl acetate |
| Synonyms: | Aceticacid, phenethyl ester (8CI);Phenethyl alcohol, acetate (6CI);2-Phenethylacetate;2-Phenylethyl acetate;Benzylcarbinyl acetate;NSC 71927;Acetic acid,2-phenylethyl ester;Phenylethyl ethanoate;b-Phenethyl acetate;b-Phenylethanol acetate;b-Phenylethyl acetate; |
| CAS: | 103-45-7 |
| EINECS: | 203-113-5 |
| Molecular Formula: | C10H12O2 |
| Molecular Weight: | 164.2 |
| InChI: | InChI=1/C10H12O2/c1-9(11)12-8-7-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.03 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.497-1.499 |
| Water Solubility: | NEGLIGIBLE |
| Solubility: | negligible |
| Appearance: | clear colorless to pale yellow liquid |
| Specification: |
Phenethyl acetate (CAS NO.103-45-7) is also named as 2-Phenethyl acetate ; 2-Phenylethyl acetate ; 4-06-00-03073 (Beilstein Handbook Reference) ; AI3-03878 ; Acetic acid, 2-phenylethyl ester ; Acetic acid, phenethyl ester ; BRN 0638179 ; Benzylcarbinyl acetate ; Ethanol, 2-phenyl-, acetate ; FEMA No. 2857 ; NSC 71927 ; Phenethyl acetate (natural) ; Phenethyl alcohol, acetate ; UNII-67733846OW ; beta-Phenylethyl acetate . Phenethyl acetate (CAS NO.103-45-7) is clear colorless to pale yellow liquid with sweet smell. It is insoluble in water, soluble in ethanol, ether and other organic solvents. |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29153990 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
 |
|
