| Identification | |
| Name: | N'-Benzyl-N,N-dimethylethylenediamine |
| Synonyms: | 2-benzylaminoethyldimethylamine; N?Benzyl-N,N-dimethylethylenediamine |
| CAS: | 103-55-9 |
| EINECS: | 203-122-4 |
| Molecular Formula: | C11H18N2 |
| Molecular Weight: | 178.27 |
| InChI: | InChI=1/C11H18N2/c1-13(2)9-8-12-10-11-6-4-3-5-7-11/h3-7,12H,8-10H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 93.3°C |
| Density: | 0.92 |
| Refractive index: | n20/D 1.509(lit.) |
| Specification: | Clear pale yellow liquid Safety Statements:26-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | III |
| Flash Point: | 93.3°C |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
