| Identification | |
| Name: | Propanoic acid,2-methyl-, 3-phenylpropyl ester |
| Synonyms: | Isobutyric acid,3-phenylpropyl ester (7CI,8CI); 1-Propanol, 3-phenyl-, isobutyrate (8CI);3-Phenylpropyl isobutyrate; Hydrocinnamyl isobutyrate; NSC 404455; NSC 6039 |
| CAS: | 103-58-2 |
| EINECS: | 203-125-0 |
| Molecular Formula: | C13H18 O2 |
| Molecular Weight: | 206.2808 |
| InChI: | InChI=1/C13H18O2/c1-11(2)13(14)15-10-6-9-12-7-4-3-5-8-12/h3-5,7-8,11H,6,9-10H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Refractive index: | n20/D 1.486(lit.) |
| Water Solubility: | insoluble in water; soluble in oils |
| Solubility: | insoluble in water; soluble in oils |
| Appearance: | Colourless liquid, fruity-balsamic sweet odour |
| Specification: | CLEAR COLOURLESS LIQUID Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
 |
|
