| Identification | |
| Name: | Propanoic acid,2-hydroxy-, (2R)- |
| Synonyms: | Lacticacid, D- (8CI);Propanoic acid, 2-hydroxy-, (R)-;(-)-Lactic acid;(2R)-2-Hydroxypropanoic acid;(R)-(-)-Lacticacid;(R)-2-Hydroxypropanoic acid;(R)-2-Hydroxypropionic acid;(R)-Lactic acid;(R)-a-Hydroxypropionic acid;D-(-)-Lactic acid;D-Lacticacid; |
| CAS: | 10326-41-7 |
| EINECS: | 233-713-2 |
| Molecular Formula: | C3H6O3 |
| Molecular Weight: | 90.08 |
| InChI: | InChI=1/C3H6O3/c1-2(4)3(5)6/h2,4H,1H3,(H,5,6)/t2-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.276g/cm3 |
| Refractive index: | 1.451 |
| Solubility: | Miscible with alcohol, glycerol, and furfural Soluble in alcohol and furfurol; slightly soluble in ether; insoluble in chloroform, petroleum ether, carbon disulfide. Miscible in alcohol-ether solution. In water, miscible |
| Color: | Crystals Yellow to colorless crystals or syrupy 50% liquid |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
