| Identification | |
| Name: | 3-Methoxyphenylboronic acid |
| Synonyms: | 3-Methoxybenzeneboronic acid;Dihydroxy-(3-methoxy-phenyl)-borane; |
| CAS: | 10365-98-7 |
| Molecular Formula: | C7H9BO3 |
| Molecular Weight: | 151.96 |
| InChI: | InChI=1/C7H9BO3/c1-11-7-4-2-3-6(5-7)8(9)10/h2-5,9-10H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.17 g/cm3 |
| Refractive index: | 1.524 |
| Appearance: | white to light yellow crystal powder |
| Specification: |
?3-Methoxyphenylboronic acid , its cas register number is 10365-98-7. It also can be called?3-Methoxybenzeneboronic acid .It is a?white to light yellow crystal powder. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
