| Identification | |
| Name: | Benzaldehyde,3-(2-thienyl)- |
| Synonyms: | 3-(Thiophen-2-yl)benzaldehyde; |
| CAS: | 103668-99-1 |
| Molecular Formula: | C11H8OS |
| Molecular Weight: | 188.25 |
| InChI: | InChI=1/C11H8OS/c12-8-9-3-1-4-10(7-9)11-5-2-6-13-11/h1-8H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.207 g/cm3 |
| Refractive index: | 1.637 |
| Appearance: | Light yellow powder |
| Specification: |
3-(2-Thienyl)benzaldehyde with cas registry number of 103668-99-1 is a kind of API intermediates. It is also called 3-Thien-2-ylbenzaldehyde with its IUPAC name of 3-Thiophen-2-ylbenzaldehyde . 3-(2-Thienyl)benzaldehyde is often used in laboratory. But it irritates to our eyes, respiratory system and skin. When you use this chemical, wear suitable gloves and eye/face protection and suitable protective clothing. If contact with eyes inadvertently, do not panic. Rinse immediately with plenty of water and seek medical advice. Besides this, 3-(2-Thienyl)benzaldehyde is also harmful by inhalation and if swallowed. So avoid to breathe dust. |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
