| Identification |
| Name: | L-Cysteine,N-acetyl-S-[(methylamino)carbonyl]- |
| Synonyms: | L-Cysteine,N-acetyl-, methylcarbamate (ester) (9CI);N-Acetyl-S-(N-methylcarbamoyl)cysteine |
| CAS: | 103974-29-4 |
| Molecular Formula: | C7H12 N2 O4 S |
| Molecular Weight: | 220.24618 |
| InChI: | InChI=1/C7H12N2O4S/c1-4(10)9-5(6(11)12)3-14-7(13)8-2/h5H,3H2,1-2H3,(H,8,13)(H,9,10)(H,11,12) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | 1.335g/cm3 |
| Refractive index: | 1.533 |
| Flash Point: | °C |
| Usage: | A urinary metabolite of the hepatotoxic experimental antitumour agent N-Methylformamide (NSC 3051) in mouse, rat and man. |
| Safety Data |
| |
 |
