| Identification | |
| Name: | Benzeneethanol,4-amino- |
| Synonyms: | Phenethylalcohol, p-amino- (6CI,7CI,8CI);2-(4-Aminophenyl)-1-ethanol;2-(4-Aminophenyl)ethanol;2-(4-Aminophenyl)ethyl alcohol;2-(p-Aminophenyl)ethanol;4-(2-Hydroxyethyl)aniline;4-(2-Hydroxyethyl)phenylamine;4-Aminobenzeneethanol;4-Aminophenethyl alcohol;NSC 409780;p-(2-Hydroxyethyl)aniline;p-Aminophenethyl alcohol; |
| CAS: | 104-10-9 |
| EINECS: | 203-174-8 |
| Molecular Formula: | C8H11NO |
| Molecular Weight: | 137.18 |
| InChI: | InChI=1/C8H11NO/c9-8-3-1-7(2-4-8)5-6-10/h1-4,10H,5-6,9H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 127.7°C |
| Boiling Point: | 255 °C |
| Density: | 1.124g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.596 |
| Appearance: | Slight brown powder |
| Specification: | LIGHT BROWN TO BROWN CRYSTALS Safety Statements:26-36-24/25 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 24/25:Avoid contact with skin and eyes |
| Flash Point: | 127.7°C |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Store under nitrogen. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
