| Identification | |
| Name: | 2-Butanone,4-(4-methoxyphenyl)- |
| Synonyms: | 2-Butanone,4-(p-methoxyphenyl)- (6CI,7CI,8CI);1-(4-Methoxyphenyl)-3-butanone;1-(p-Methoxyphenyl)-3-butanone;4-(p-Methoxyphenyl)-2-butanone;4-Methoxybenzylacetone;4-[4-(Methyloxy)phenyl]-2-butanone;Anisylacetone;ENT 20279;NSC 405366;Raspberry ketone methyl ether; |
| CAS: | 104-20-1 |
| EINECS: | 203-184-2 |
| Molecular Formula: | C11H14O2 |
| Molecular Weight: | 178.23 |
| InChI: | InChI=1/C11H14O2/c1-9(12)3-4-10-5-7-11(13-2)8-6-10/h5-8H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 112°C |
| Density: | 1.046 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.519-1.521 |
| Appearance: | Pale yellow - colorless liquid. |
| Specification: | clear colourless to pale yellow liquid Safety Statements:23-24/25 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 24/25:Avoid contact with skin and eyes |
| Flash Point: | 112°C |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Usage: | Herbicide. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
