| Identification | |
| Name: | 1,2-Propanediol,3-(4-chlorophenoxy)- |
| Synonyms: | 1,2-Propanediol,3-(p-chlorophenoxy)- (6CI,7CI,8CI);3-(4-Chlorophenoxy)-1,2-propanediol;3-(p-Chlorophenoxy)propane-1,2-diol;Adermykon;Chlorphenesin;Demykon;ElestabCPN;Gecophen;Glycerol a-p-chlorophenyl ether;Mycil;NSC 6401;p-Chlorophenyl glyceryl ether;p-Chlorophenyl-a-glycerylether;p-Chlorphenesin; |
| CAS: | 104-29-0 |
| EINECS: | 203-192-6 |
| Molecular Formula: | C9H11ClO3 |
| Molecular Weight: | 202.64 |
| InChI: | InChI=1/C9H11ClO3/c10-7-1-3-9(4-2-7)13-6-8(12)5-11/h1-4,8,11-12H,5-6H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Flash Point: | 177.2°C |
| Boiling Point: | 369.5°Cat760mmHg |
| Density: | 1.317g/cm3 |
| Refractive index: | 1.565 |
| Solubility: |
Appearance:white to off-white crystalline powder Transport Information: OTH Hazard Symbols:UN NO. particular:particular |
| Appearance: | white to off-white crystalline powder |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 177.2°C |
| Safety Data | |
| Hazard Symbols | |
 |
|
