| Identification | |
| Name: | Benzene,1-methoxy-4-propyl- |
| Synonyms: | Anisole,p-propyl- (6CI,7CI,8CI); 1-Methoxy-4-propylbenzene; 4-Methoxy-1-propylbenzene;4-Propylanisole; 4-n-Propylanisole; Dihydroanethole; Methyl p-propylphenylether; NSC 37996; p-Propylanisole; p-Propylphenol methyl ether |
| CAS: | 104-45-0 |
| EINECS: | 203-203-4 |
| Molecular Formula: | C10H14 O |
| Molecular Weight: | 150.24 |
| InChI: | InChI=1/C10H14O/c1-3-4-9-5-7-10(11-2)8-6-9/h5-8H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Refractive index: | n20/D 1.504(lit.) |
| Specification: | Safety Statements:61 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
| Hazard Symbols |
N: Dangerous for the environment
|
 |
|
