| Identification | |
| Name: | Benzene,1-methoxy-4-(1-propen-1-yl)- |
| Synonyms: | Anise camphor;Isoestragole;NSC 4018;Nauli gum;Oil of aniseed;p-1-Propenylanisole;p-Anethole;p-Methoxy-b-methylstyrene;p-Propenylanisole;p-Propenylphenyl methyl ether;Anisole,p-propenyl- (8CI);Benzene, 1-methoxy-4-(1-propenyl)- (9CI);1-Methoxy-4-(1-propenyl)benzene;1-Methoxy-4-propenylbenzene;1-Propene,1-(4-methoxyphenyl)-;4-(1-Propenyl)anisole;4-Methoxy-1-propenylbenzene;4-Methoxypropenylbenzene;4-Propenylanisole;Anethol; |
| CAS: | 104-46-1 |
| EINECS: | 203-205-5 |
| Molecular Formula: | C10H12O |
| Molecular Weight: | 148.2 |
| InChI: | InChI=1/C10H12O/c1-3-4-9-5-7-10(11-2)8-6-9/h3-8H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.9865 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | n20/D 1.561(lit.) |
| Water Solubility: | slight |
| Solubility: | slight |
| Appearance: | Colourless,clear, liquid |
| Specification: |
Anethole ,its CAS NO. is 104-46-1,the synonyms is 1-Methoxy-4-(1-propenyl)benzene ; 1-Methoxy-4-propenylbenzene ; 1-Propene, 1-(4-methoxyphenyl)- ; 2-06-00-00523 (Beilstein Handbook Reference) ; 4-Methoxy-1-propenylbenzene ; 4-Methoxypropenylbenzene ; 4-Propenylanisole ; AI3-00380 ; Anise camphor ; Aniskampfer ; Anisole, p-propenyl- ; BRN 0774229 ; Benzene, 1-methoxy-4-(1-propenyl)- ; CCRIS 6211 ; Caswell No. 051B ; EINECS 203-205-5 ; EPA Pesticide Chemical Code 015604 ; FEMA Number 2086 ; HSDB 1427 ; Isoestragole ; Monasirup ; NSC 4018 ; Nauli "gum" ; Oil of aniseed ; Propene, 1-(p-methoxyphenyl)- ; UNII-A79C64YD3Q ; p-1-Propenylanisole ; p-Anethole ; p-Methoxy-beta-methylstyrene ; p-Propenylanisole ; p-Propenylmethoxybenzene ; p-Propenylphenyl methyl ether . |
| Color: | White crystals |
| Usage: | Accounts for the distinctive licorice flavor of anise, fennel, star anise, and anise myrtle. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
