| Identification | ||
| Name: | p-Tolunitrile | |
| Synonyms: | 4-Methylbenzenecarbonitrile; CNT; para-tolunitrile; p-toluonitrile; 4-Methylbenzonitrile; p-Tolunitrile; P-toluenenitrile; 4-cyano-toluene; p-Methylbenzonitrile | |
| CAS: | 104-85-8 | |
| EINECS: | 203-244-8 | |
| Molecular Formula: | C8H7N | |
| Molecular Weight: | 117.15 | |
| InChI: | InChI=1/C8H7N/c1-7-2-4-8(6-9)5-3-7/h2-5H,1H3 | |
| Molecular Structure: |  |
|
| Properties | ||
| Transport: | 61639? | |
| Density: | 0.981 | |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong bases. | |
| Refractive index: | 1.5285-1.5305 | |
| Water Solubility: | <0.1 g/100 mL at 17 ºC | |
| Solubility: | <0.1 g/100 mL at 17 oC | |
| Appearance: | Clear, Colorless Liquid or crystal | |
| Specification: | beige solid Safety Statements:26-36/37-37-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37:Wear suitable protective clothing and gloves 37:Wear suitable gloves 36:Wear suitable protective clothing | |
| Packinggroup: | I; II | |
| HS Code: | 29269095 | |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. | |
| Safety Data | ||
| Hazard Symbols |
Xi:Irritant
|
|
 |
||
