| Identification | |
| Name: | 5-Ethyl-2-methylpyridine |
| Synonyms: | 5-Ethyl-2-picoline; 2-Methyl-5-Ethylyridine; 2-Methyl-5-Ethylpyridine |
| CAS: | 104-90-5 |
| EINECS: | 203-250-0 |
| Molecular Formula: | C8H11N |
| Molecular Weight: | 121.18 |
| InChI: | InChI=1/C8H11N/c1-3-8-5-4-7(2)9-6-8/h4-6H,3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2300 |
| Density: | 0.919 |
| Stability: | Stable. Hygroscopic. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.496-1.498 |
| Water Solubility: | practically insoluble |
| Solubility: | practically insoluble |
| Appearance: | liquid |
| Packinggroup: | III |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Keep from contact with oxidizing materials. Store in a cool, dry, well-ventilated area away from incompatible substances. Corrosives area. Store protected from moisture. Do not store in copper or copper alloy storage vessels. |
| Color: | Colorless liquid |
| Usage: | 5-Ethyl-2-methylpyridine is used as specific solvent and as intermediate for several chemical reactions. Attributes PIS available on request. Please contact us. Contact |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
