| Identification | |
| Name: | Butanoic acid,4-(2,4-dichlorophenoxy)-, sodium salt (1:1) |
| Synonyms: | Butanoicacid, 4-(2,4-dichlorophenoxy)-, sodium salt (9CI); Butyric acid,4-(2,4-dichlorophenoxy)-, sodium salt (8CI); 2,4-DB sodium salt; Embutone;Embutox; Embutox E; SYS 67B; Sodium 2,4-dichlorophenoxybutyrate |
| CAS: | 10433-59-7 |
| EINECS: | 233-917-1 |
| Molecular Formula: | C10H10 Cl2 O3 . Na |
| Molecular Weight: | 271.08 |
| InChI: | InChI=1/C10H10Cl2O3.Na/c11-7-3-4-9(8(12)6-7)15-5-1-2-10(13)14;/h3-4,6H,1-2,5H2,(H,13,14);/q;+1/p-1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2588 |
| Melting Point: | 118-120 deg C |
| Flash Point: | 202°C |
| Boiling Point: | 410.4°C at 760 mmHg |
| Solubility: | Water solubility: 46 ppm at 25 deg C. Readily soluble in acetone, ethanol, and diethyl ether. Slightly soluble in benzene, toluene, and kerosene. |
| Specification: |
Embutox ,its cas register number is 10433-59-7. It also can be called 2,4-DB-sodium ; Butanoic acid, 4-(2,4-dichlorophenoxy)-, sodium salt ; and Sodium 4-(2,4-dichlorophenoxy)butyrate . |
| Report: |
EPA Genetic Toxicology Program. |
| Packinggroup: | III |
| Flash Point: | 202°C |
| Color: | White crystals White to light brown crystals |
| Safety Data | |
 |
|
