| Identification | |
| Name: | L-Tyrosine,O-(4-hydroxyphenyl)-3-iodo- |
| Synonyms: | Alanine,3-[4-(p-hydroxyphenoxy)-3-iodophenyl]-, L- (8CI); 3-Iodo-L-thyronine;3-Monoiodothyronine; O-(4-Hydroxyphenyl)-3-iodo-L-tyrosine |
| CAS: | 10468-90-3 |
| EINECS: | 233-955-9 |
| Molecular Formula: | C15H14 I N O4 |
| Molecular Weight: | 399.18 |
| InChI: | InChI=1/C15H14INO4/c16-12-7-9(8-13(17)15(19)20)1-6-14(12)21-11-4-2-10(18)3-5-11/h1-7,13,18H,8,17H2,(H,19,20)/t13-/m0/s1 |
| Molecular Structure: | ![(C15H14INO4) Alanine,3-[4-(p-hydroxyphenoxy)-3-iodophenyl]-, L- (8CI); 3-Iodo-L-thyronine;3-Monoiodothyronine; O-...](https://img1.guidechem.com/chem/e/dict/148/10468-90-3.jpg) |
| Properties | |
| Flash Point: | 265.8°C |
| Boiling Point: | 515.9°Cat760mmHg |
| Density: | 1.746g/cm3 |
| Refractive index: | 1.683 |
| Specification: | Tan-to-Light Brown Solid usageEng:A metabolite of thyroid hormone. Of interest for the early detection and treatment of congenital or drug-induced hypothyroidism in the developing human fetus |
| Flash Point: | 265.8°C |
| Usage: | A metabolite of thyroid hormone. Of interest for the early detection and treatment of congenital or drug-induced hypothyroidism in the developing human fetus |
| Safety Data | |
 |
|
