| Identification | |
| Name: | 2-Propene-1,1-diol,2-methyl-, 1,1-diacetate |
| Synonyms: | 2-Propene-1,1-diol,2-methyl-, diacetate (6CI,7CI,8CI,9CI); 2-Methyl-2-propene-1,1-diol diacetate;2-Methyl-2-propenylidene diacetate; 2-Methylallylidene diacetate;3,3-Diacetoxy-2-methyl-1-propene; 3,3-Diacetoxy-2-methylpropene; Methacroleindiacetate; NSC 46577 |
| CAS: | 10476-95-6 |
| EINECS: | 233-974-2 |
| Molecular Formula: | C8H12 O4 |
| Molecular Weight: | 172.20 |
| InChI: | InChI=1/C8H12O4/c1-5(2)8(11-6(3)9)12-7(4)10/h8H,1H2,2-4H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2810 6 |
| Density: | 1.057 g/cm3 |
| Refractive index: | n20/D 1.424(lit.) |
| Specification: | Safety Statements:23-26-27-36/37/39-45 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 27:Take off immediately all contaminated clothing 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | II |
| Safety Data | |
| Hazard Symbols |
T+: Very toxic
|
 |
|
